C16H22N4OS2 — CID 118766874
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]propanamide (PubChem CID 118766874) has the molecular formula C16H22N4OS2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]propanamide.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]propanamide |
|---|---|
| PubChem CID | 118766874 |
| Molecular Formula | C16H22N4OS2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]propanamide |
| SMILES | Cc1cc(C)nc(SC(C)C(=O)NCCCc2scnc2C)n1 |
| InChI | InChI=1S/C16H22N4OS2/c1-10-8-11(2)20-16(19-10)23-13(4)15(21)17-7-5-6-14-12(3)18-9-22-14/h8-9,13H,5-7H2,1-4H3,(H,17,21) |
| InChIKey | CUBPHOHNLGXJDD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|