C19H24N4O2 — CID 118768094
2-(3-aminopropoxy)-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-4-methylbenzamide (PubChem CID 118768094) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-(3-aminopropoxy)-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-4-methylbenzamide.
| Compound Name | 2-(3-aminopropoxy)-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 118768094 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-(3-aminopropoxy)-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2ncc3c(n2)CCC3)c(OCCCN)c1 |
| InChI | InChI=1S/C19H24N4O2/c1-13-6-7-15(17(10-13)25-9-3-8-20)19(24)22-12-18-21-11-14-4-2-5-16(14)23-18/h6-7,10-11H,2-5,8-9,12,20H2,1H3,(H,22,24) |
| InChIKey | FAQAAMAGLMVAAX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|