C18H24N4O2 — CID 118791993
3-(3-aminopropoxy)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]-4-methylbenzamide (PubChem CID 118791993) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-(3-aminopropoxy)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]-4-methylbenzamide.
| Compound Name | 3-(3-aminopropoxy)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 118791993 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 3-(3-aminopropoxy)-N-[(4,6-dimethylpyrimidin-2-yl)methyl]-4-methylbenzamide |
| SMILES | Cc1cc(C)nc(CNC(=O)c2ccc(C)c(OCCCN)c2)n1 |
| InChI | InChI=1S/C18H24N4O2/c1-12-5-6-15(10-16(12)24-8-4-7-19)18(23)20-11-17-21-13(2)9-14(3)22-17/h5-6,9-10H,4,7-8,11,19H2,1-3H3,(H,20,23) |
| InChIKey | YINYKWUSEVXELQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|