C15H17ClN4O3 — CID 118771147
3-(2-aminoethoxy)-N-[(5-chloropyrimidin-2-yl)methyl]-4-methoxybenzamide (PubChem CID 118771147) has the molecular formula C15H17ClN4O3 and a molecular weight of 336.78 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-N-[(5-chloropyrimidin-2-yl)methyl]-4-methoxybenzamide.
| Compound Name | 3-(2-aminoethoxy)-N-[(5-chloropyrimidin-2-yl)methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 118771147 |
| Molecular Formula | C15H17ClN4O3 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 3-(2-aminoethoxy)-N-[(5-chloropyrimidin-2-yl)methyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2ncc(Cl)cn2)cc1OCCN |
| InChI | InChI=1S/C15H17ClN4O3/c1-22-12-3-2-10(6-13(12)23-5-4-17)15(21)20-9-14-18-7-11(16)8-19-14/h2-3,6-8H,4-5,9,17H2,1H3,(H,20,21) |
| InChIKey | POLBEHVRSYPYAE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |