C17H29N3O6S — CID 154903818
acetic acid;3-(3-aminopropoxy)-N-[2-(dimethylsulfamoyl)ethyl]-4-methylbenzamide (PubChem CID 154903818) has the molecular formula C17H29N3O6S and a molecular weight of 403.50 g/mol. Its IUPAC name is acetic acid;3-(3-aminopropoxy)-N-[2-(dimethylsulfamoyl)ethyl]-4-methylbenzamide.
| Compound Name | acetic acid;3-(3-aminopropoxy)-N-[2-(dimethylsulfamoyl)ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 154903818 |
| Molecular Formula | C17H29N3O6S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | acetic acid;3-(3-aminopropoxy)-N-[2-(dimethylsulfamoyl)ethyl]-4-methylbenzamide |
| SMILES | CC(=O)O.Cc1ccc(C(=O)NCCS(=O)(=O)N(C)C)cc1OCCCN |
| InChI | InChI=1S/C15H25N3O4S.C2H4O2/c1-12-5-6-13(11-14(12)22-9-4-7-16)15(19)17-8-10-23(20,21)18(2)3;1-2(3)4/h5-6,11H,4,7-10,16H2,1-3H3,(H,17,19);1H3,(H,3,4) |
| InChIKey | AJUMPJHWPOCVJT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|