C18H22N6O3 — CID 118770452
1,3-dimethyl-N-(1-methylbenzimidazol-5-yl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxamide (PubChem CID 118770452) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1,3-dimethyl-N-(1-methylbenzimidazol-5-yl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxamide.
| Compound Name | 1,3-dimethyl-N-(1-methylbenzimidazol-5-yl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 118770452 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1,3-dimethyl-N-(1-methylbenzimidazol-5-yl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
| SMILES | CN1C(=O)N(C)C2(CCN(C(=O)Nc3ccc4c(c3)ncn4C)CC2)C1=O |
| InChI | InChI=1S/C18H22N6O3/c1-21-11-19-13-10-12(4-5-14(13)21)20-16(26)24-8-6-18(7-9-24)15(25)22(2)17(27)23(18)3/h4-5,10-11H,6-9H2,1-3H3,(H,20,26) |
| InChIKey | VOBCFYOXEANFJX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|