C17H27N7O3 — CID 122564907
1,3-dimethyl-2,4-dioxo-N-[1-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]-1,3,8-triazaspiro[4.5]decane-8-carboxamide (PubChem CID 122564907) has the molecular formula C17H27N7O3 and a molecular weight of 377.45 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-N-[1-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]-1,3,8-triazaspiro[4.5]decane-8-carboxamide.
| Compound Name | 1,3-dimethyl-2,4-dioxo-N-[1-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 122564907 |
| Molecular Formula | C17H27N7O3 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-N-[1-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
| SMILES | CC(NC(=O)N1CCC2(CC1)C(=O)N(C)C(=O)N2C)c1nncn1C(C)C |
| InChI | InChI=1S/C17H27N7O3/c1-11(2)24-10-18-20-13(24)12(3)19-15(26)23-8-6-17(7-9-23)14(25)21(4)16(27)22(17)5/h10-12H,6-9H2,1-5H3,(H,19,26) |
| InChIKey | HLSDWXDNMRDZAO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|