C16H23N2+ — CID 11877261
[(1S,2S)-2-(5,7-dimethyl-1H-indol-3-yl)cyclohexyl]azanium (PubChem CID 11877261) has the molecular formula C16H23N2+ and a molecular weight of 243.37 g/mol. Its IUPAC name is [(1S,2S)-2-(5,7-dimethyl-1H-indol-3-yl)cyclohexyl]azanium.
| Compound Name | [(1S,2S)-2-(5,7-dimethyl-1H-indol-3-yl)cyclohexyl]azanium |
|---|---|
| PubChem CID | 11877261 |
| Molecular Formula | C16H23N2+ |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | [(1S,2S)-2-(5,7-dimethyl-1H-indol-3-yl)cyclohexyl]azanium |
| SMILES | Cc1cc(C)c2[nH]cc([C@@H]3CCCC[C@@H]3[NH3+])c2c1 |
| InChI | InChI=1S/C16H22N2/c1-10-7-11(2)16-13(8-10)14(9-18-16)12-5-3-4-6-15(12)17/h7-9,12,15,18H,3-6,17H2,1-2H3/p+1/t12-,15-/m0/s1 |
| InChIKey | MOSRQZQHYDDGSV-WFASDCNBSA-O |
| XLogP | 3.05 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |