C17H24ClN3O3 — CID 118774005
1-[2-(3-aminopropoxy)-4-chlorobenzoyl]-N-methylpiperidine-2-carboxamide (PubChem CID 118774005) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is 1-[2-(3-aminopropoxy)-4-chlorobenzoyl]-N-methylpiperidine-2-carboxamide.
| Compound Name | 1-[2-(3-aminopropoxy)-4-chlorobenzoyl]-N-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 118774005 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-[2-(3-aminopropoxy)-4-chlorobenzoyl]-N-methylpiperidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCCN1C(=O)c1ccc(Cl)cc1OCCCN |
| InChI | InChI=1S/C17H24ClN3O3/c1-20-16(22)14-5-2-3-9-21(14)17(23)13-7-6-12(18)11-15(13)24-10-4-8-19/h6-7,11,14H,2-5,8-10,19H2,1H3,(H,20,22) |
| InChIKey | KQWANRYCHZFFRQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|