C16H23ClN2O4 — CID 154906698
acetic acid;[2-(3-aminopropoxy)-4-chlorophenyl]-pyrrolidin-1-ylmethanone (PubChem CID 154906698) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is acetic acid;[2-(3-aminopropoxy)-4-chlorophenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | acetic acid;[2-(3-aminopropoxy)-4-chlorophenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 154906698 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | acetic acid;[2-(3-aminopropoxy)-4-chlorophenyl]-pyrrolidin-1-ylmethanone |
| SMILES | CC(=O)O.NCCCOc1cc(Cl)ccc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H19ClN2O2.C2H4O2/c15-11-4-5-12(13(10-11)19-9-3-6-16)14(18)17-7-1-2-8-17;1-2(3)4/h4-5,10H,1-3,6-9,16H2;1H3,(H,3,4) |
| InChIKey | PPCPBPPBTHIVFB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|