C20H27ClN4O4 — CID 172910277
acetic acid;[2-(3-aminopropoxy)-4-chlorophenyl]-[3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]methanone (PubChem CID 172910277) has the molecular formula C20H27ClN4O4 and a molecular weight of 422.91 g/mol. Its IUPAC name is acetic acid;[2-(3-aminopropoxy)-4-chlorophenyl]-[3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]methanone.
| Compound Name | acetic acid;[2-(3-aminopropoxy)-4-chlorophenyl]-[3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 172910277 |
| Molecular Formula | C20H27ClN4O4 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | acetic acid;[2-(3-aminopropoxy)-4-chlorophenyl]-[3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]methanone |
| SMILES | CC(=O)O.Cc1cc(C)n(C2CN(C(=O)c3ccc(Cl)cc3OCCCN)C2)n1 |
| InChI | InChI=1S/C18H23ClN4O2.C2H4O2/c1-12-8-13(2)23(21-12)15-10-22(11-15)18(24)16-5-4-14(19)9-17(16)25-7-3-6-20;1-2(3)4/h4-5,8-9,15H,3,6-7,10-11,20H2,1-2H3;1H3,(H,3,4) |
| InChIKey | BZUKCGOTGLYZTH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|