C16H18N4OS — CID 118777319
[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-(2,5-dihydro-1H-pyrrol-2-yl)methanone (PubChem CID 118777319) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-(2,5-dihydro-1H-pyrrol-2-yl)methanone.
| Compound Name | [4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-(2,5-dihydro-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 118777319 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | [4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-(2,5-dihydro-1H-pyrrol-2-yl)methanone |
| SMILES | O=C(C1C=CCN1)N1CCN(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C16H18N4OS/c21-15(13-5-3-7-17-13)19-8-10-20(11-9-19)16-18-12-4-1-2-6-14(12)22-16/h1-6,13,17H,7-11H2 |
| InChIKey | GHHGKSSIRLKSLM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|