C19H22N4O2 — CID 118780102
[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[3-(5-methoxy-1-methyl-1,2,4-triazol-3-yl)phenyl]methanone (PubChem CID 118780102) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is [(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[3-(5-methoxy-1-methyl-1,2,4-triazol-3-yl)phenyl]methanone.
| Compound Name | [(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[3-(5-methoxy-1-methyl-1,2,4-triazol-3-yl)phenyl]methanone |
|---|---|
| PubChem CID | 118780102 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | [(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[3-(5-methoxy-1-methyl-1,2,4-triazol-3-yl)phenyl]methanone |
| SMILES | COc1nc(-c2cccc(C(=O)N3C[C@H]4CC=CC[C@H]4C3)c2)nn1C |
| InChI | InChI=1S/C19H22N4O2/c1-22-19(25-2)20-17(21-22)13-8-5-9-14(10-13)18(24)23-11-15-6-3-4-7-16(15)12-23/h3-5,8-10,15-16H,6-7,11-12H2,1-2H3/t15-,16+ |
| InChIKey | AZVJKBPTURQQIN-IYBDPMFKSA-N |
| XLogP | 2.53 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|