C22H22N4O — CID 122557539
[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[3-(3-amino-1H-indazol-5-yl)phenyl]methanone (PubChem CID 122557539) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is [(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[3-(3-amino-1H-indazol-5-yl)phenyl]methanone.
| Compound Name | [(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[3-(3-amino-1H-indazol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 122557539 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[3-(3-amino-1H-indazol-5-yl)phenyl]methanone |
| SMILES | Nc1n[nH]c2ccc(-c3cccc(C(=O)N4C[C@H]5CC=CC[C@H]5C4)c3)cc12 |
| InChI | InChI=1S/C22H22N4O/c23-21-19-11-15(8-9-20(19)24-25-21)14-6-3-7-16(10-14)22(27)26-12-17-4-1-2-5-18(17)13-26/h1-3,6-11,17-18H,4-5,12-13H2,(H3,23,24,25)/t17-,18+ |
| InChIKey | VHKCNCYUVSWSOY-HDICACEKSA-N |
| XLogP | 3.85 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|