C16H14N4O — CID 130423644
(3-amino-1H-indazol-5-yl)-(2-phenylaziridin-1-yl)methanone (PubChem CID 130423644) has the molecular formula C16H14N4O and a molecular weight of 278.32 g/mol. Its IUPAC name is (3-amino-1H-indazol-5-yl)-(2-phenylaziridin-1-yl)methanone.
| Compound Name | (3-amino-1H-indazol-5-yl)-(2-phenylaziridin-1-yl)methanone |
|---|---|
| PubChem CID | 130423644 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (3-amino-1H-indazol-5-yl)-(2-phenylaziridin-1-yl)methanone |
| SMILES | Nc1n[nH]c2ccc(C(=O)N3CC3c3ccccc3)cc12 |
| InChI | InChI=1S/C16H14N4O/c17-15-12-8-11(6-7-13(12)18-19-15)16(21)20-9-14(20)10-4-2-1-3-5-10/h1-8,14H,9H2,(H3,17,18,19) |
| InChIKey | BPEUXIFNNVBADI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|