C19H22N4O — CID 130450270
(3-amino-1H-indazol-5-yl)-[(2R)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidin-1-yl]methanone (PubChem CID 130450270) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is (3-amino-1H-indazol-5-yl)-[(2R)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidin-1-yl]methanone.
| Compound Name | (3-amino-1H-indazol-5-yl)-[(2R)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 130450270 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (3-amino-1H-indazol-5-yl)-[(2R)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidin-1-yl]methanone |
| SMILES | C=C(/C=C\C=C/C)[C@H]1CCCN1C(=O)c1ccc2[nH]nc(N)c2c1 |
| InChI | InChI=1S/C19H22N4O/c1-3-4-5-7-13(2)17-8-6-11-23(17)19(24)14-9-10-16-15(12-14)18(20)22-21-16/h3-5,7,9-10,12,17H,2,6,8,11H2,1H3,(H3,20,21,22)/b4-3-,7-5-/t17-/m1/s1 |
| InChIKey | ZQSWFKJXMYZWKB-XGSDDXMCSA-N |
| XLogP | 3.44 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|