C21H23N5O2 — CID 122566998
1-[4-[3-(3-amino-1H-indazol-5-yl)benzoyl]-1,4-diazepan-1-yl]ethanone (PubChem CID 122566998) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-[4-[3-(3-amino-1H-indazol-5-yl)benzoyl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-[3-(3-amino-1H-indazol-5-yl)benzoyl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 122566998 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-[4-[3-(3-amino-1H-indazol-5-yl)benzoyl]-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(C(=O)c2cccc(-c3ccc4[nH]nc(N)c4c3)c2)CC1 |
| InChI | InChI=1S/C21H23N5O2/c1-14(27)25-8-3-9-26(11-10-25)21(28)17-5-2-4-15(12-17)16-6-7-19-18(13-16)20(22)24-23-19/h2,4-7,12-13H,3,8-11H2,1H3,(H3,22,23,24) |
| InChIKey | ADFOETJIXYDKQD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |