About 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide
3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide (PubChem CID 70920294) has the molecular formula C17H17N5O3
and a molecular weight of 339.36 g/mol. Its IUPAC name is 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide.
Molecular Properties
| Compound Name | 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide |
| PubChem CID | 70920294 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide |
| SMILES | Nc1n[nH]c2ccc(C(=O)NNC(=O)C[C@@H](O)c3ccccc3)cc12 |
| InChI | InChI=1S/C17H17N5O3/c18-16-12-8-11(6-7-13(12)19-21-16)17(25)22-20-15(24)9-14(23)10-4-2-1-3-5-10/h1-8,14,23H,9H2,(H,20,24)(H,22,25)(H3,18,19,21)/t14-/m1/s1 |
| InChIKey | PBGDPGJKRXMIKR-CQSZACIVSA-N |
| XLogP | 1.03 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide?
The IUPAC name of 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide (CID 70920294) is 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide.
What is the SMILES notation for 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide?
The canonical SMILES for 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide is Nc1n[nH]c2ccc(C(=O)NNC(=O)C[C@@H](O)c3ccccc3)cc12.
What is the InChIKey of 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide?
The InChIKey is PBGDPGJKRXMIKR-CQSZACIVSA-N. The full InChI is InChI=1S/C17H17N5O3/c18-16-12-8-11(6-7-13(12)19-21-16)17(25)22-20-15(24)9-14(23)10-4-2-1-3-5-10/h1-8,14,23H,9H2,(H,20,24)(H,22,25)(H3,18,19,21)/t14-/m1/s1.
What are the key properties of 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide?
3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide has a molecular weight of 339.36 g/mol, XLogP of 1.03, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N'-[(3R)-3-hydroxy-3-phenylpropanoyl]-1H-indazole-5-carbohydrazide is sourced from PubChem (CID 70920294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).