C21H23N5 — CID 170069864
5-[(2E,4E)-5-(methylideneamino)-4-[[(1S)-1-phenylethyl]amino]penta-2,4-dien-2-yl]-1H-indazol-3-amine (PubChem CID 170069864) has the molecular formula C21H23N5 and a molecular weight of 345.45 g/mol. Its IUPAC name is 5-[(2E,4E)-5-(methylideneamino)-4-[[(1S)-1-phenylethyl]amino]penta-2,4-dien-2-yl]-1H-indazol-3-amine.
| Compound Name | 5-[(2E,4E)-5-(methylideneamino)-4-[[(1S)-1-phenylethyl]amino]penta-2,4-dien-2-yl]-1H-indazol-3-amine |
|---|---|
| PubChem CID | 170069864 |
| Molecular Formula | C21H23N5 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 5-[(2E,4E)-5-(methylideneamino)-4-[[(1S)-1-phenylethyl]amino]penta-2,4-dien-2-yl]-1H-indazol-3-amine |
| SMILES | C=N/C=C(\C=C(/C)c1ccc2[nH]nc(N)c2c1)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C21H23N5/c1-14(17-9-10-20-19(12-17)21(22)26-25-20)11-18(13-23-3)24-15(2)16-7-5-4-6-8-16/h4-13,15,24H,3H2,1-2H3,(H3,22,25,26)/b14-11+,18-13+/t15-/m0/s1 |
| InChIKey | WPMRPSBTUFLLFA-WPSYXOEJSA-N |
| XLogP | 4.44 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|