C20H16F3N5O — CID 135200499
5-[(2E,4E)-5-(methylideneamino)-4-(trifluoromethyl)penta-2,4-dien-2-yl]-N-pyridin-3-yl-1H-indazole-3-carboxamide (PubChem CID 135200499) has the molecular formula C20H16F3N5O and a molecular weight of 399.38 g/mol. Its IUPAC name is 5-[(2E,4E)-5-(methylideneamino)-4-(trifluoromethyl)penta-2,4-dien-2-yl]-N-pyridin-3-yl-1H-indazole-3-carboxamide.
| Compound Name | 5-[(2E,4E)-5-(methylideneamino)-4-(trifluoromethyl)penta-2,4-dien-2-yl]-N-pyridin-3-yl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 135200499 |
| Molecular Formula | C20H16F3N5O |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 5-[(2E,4E)-5-(methylideneamino)-4-(trifluoromethyl)penta-2,4-dien-2-yl]-N-pyridin-3-yl-1H-indazole-3-carboxamide |
| SMILES | C=N/C=C(\C=C(/C)c1ccc2[nH]nc(C(=O)Nc3cccnc3)c2c1)C(F)(F)F |
| InChI | InChI=1S/C20H16F3N5O/c1-12(8-14(10-24-2)20(21,22)23)13-5-6-17-16(9-13)18(28-27-17)19(29)26-15-4-3-7-25-11-15/h3-11H,2H2,1H3,(H,26,29)(H,27,28)/b12-8+,14-10+ |
| InChIKey | AKQQZRWFEKZKSU-HNXSEKISSA-N |
| XLogP | 4.76 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|