C24H26N6O — CID 155017777
5-[(2E,4E)-5-(methylideneamino)-4-(pyrrolidin-1-ylmethyl)penta-2,4-dien-2-yl]-N-pyridin-3-yl-1H-indazole-3-carboxamide (PubChem CID 155017777) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 5-[(2E,4E)-5-(methylideneamino)-4-(pyrrolidin-1-ylmethyl)penta-2,4-dien-2-yl]-N-pyridin-3-yl-1H-indazole-3-carboxamide.
| Compound Name | 5-[(2E,4E)-5-(methylideneamino)-4-(pyrrolidin-1-ylmethyl)penta-2,4-dien-2-yl]-N-pyridin-3-yl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 155017777 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 5-[(2E,4E)-5-(methylideneamino)-4-(pyrrolidin-1-ylmethyl)penta-2,4-dien-2-yl]-N-pyridin-3-yl-1H-indazole-3-carboxamide |
| SMILES | C=N/C=C(\C=C(/C)c1ccc2[nH]nc(C(=O)Nc3cccnc3)c2c1)CN1CCCC1 |
| InChI | InChI=1S/C24H26N6O/c1-17(12-18(14-25-2)16-30-10-3-4-11-30)19-7-8-22-21(13-19)23(29-28-22)24(31)27-20-6-5-9-26-15-20/h5-9,12-15H,2-4,10-11,16H2,1H3,(H,27,31)(H,28,29)/b17-12+,18-14+ |
| InChIKey | ICKKORLWXXSMGN-NXGXIAAHSA-N |
| XLogP | 4.29 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|