C26H29N5O3S — CID 155007893
5-[(3E,5E)-7-(1,1-dioxo-1,4-thiazinan-4-yl)-2,6-dimethylhepta-1,3,5-trien-4-yl]-N-pyridin-3-yl-1H-indazole-3-carboxamide (PubChem CID 155007893) has the molecular formula C26H29N5O3S and a molecular weight of 491.62 g/mol. Its IUPAC name is 5-[(3E,5E)-7-(1,1-dioxo-1,4-thiazinan-4-yl)-2,6-dimethylhepta-1,3,5-trien-4-yl]-N-pyridin-3-yl-1H-indazole-3-carboxamide.
| Compound Name | 5-[(3E,5E)-7-(1,1-dioxo-1,4-thiazinan-4-yl)-2,6-dimethylhepta-1,3,5-trien-4-yl]-N-pyridin-3-yl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 155007893 |
| Molecular Formula | C26H29N5O3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 5-[(3E,5E)-7-(1,1-dioxo-1,4-thiazinan-4-yl)-2,6-dimethylhepta-1,3,5-trien-4-yl]-N-pyridin-3-yl-1H-indazole-3-carboxamide |
| SMILES | C=C(C)/C=C(\C=C(/C)CN1CCS(=O)(=O)CC1)c1ccc2[nH]nc(C(=O)Nc3cccnc3)c2c1 |
| InChI | InChI=1S/C26H29N5O3S/c1-18(2)13-21(14-19(3)17-31-9-11-35(33,34)12-10-31)20-6-7-24-23(15-20)25(30-29-24)26(32)28-22-5-4-8-27-16-22/h4-8,13-16H,1,9-12,17H2,2-3H3,(H,28,32)(H,29,30)/b19-14+,21-13+ |
| InChIKey | YUYURHROLSJFNL-PLVHOZOXSA-N |
| XLogP | 3.85 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|