C25H26ClN5O — CID 130368490
5-[(2E,4E)-4-chloro-5-(methylideneamino)penta-2,4-dien-2-yl]-N-[4-(pyrrolidin-1-ylmethyl)phenyl]-1H-indazole-3-carboxamide (PubChem CID 130368490) has the molecular formula C25H26ClN5O and a molecular weight of 447.97 g/mol. Its IUPAC name is 5-[(2E,4E)-4-chloro-5-(methylideneamino)penta-2,4-dien-2-yl]-N-[4-(pyrrolidin-1-ylmethyl)phenyl]-1H-indazole-3-carboxamide.
| Compound Name | 5-[(2E,4E)-4-chloro-5-(methylideneamino)penta-2,4-dien-2-yl]-N-[4-(pyrrolidin-1-ylmethyl)phenyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 130368490 |
| Molecular Formula | C25H26ClN5O |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 5-[(2E,4E)-4-chloro-5-(methylideneamino)penta-2,4-dien-2-yl]-N-[4-(pyrrolidin-1-ylmethyl)phenyl]-1H-indazole-3-carboxamide |
| SMILES | C=N/C=C(Cl)\C=C(/C)c1ccc2[nH]nc(C(=O)Nc3ccc(CN4CCCC4)cc3)c2c1 |
| InChI | InChI=1S/C25H26ClN5O/c1-17(13-20(26)15-27-2)19-7-10-23-22(14-19)24(30-29-23)25(32)28-21-8-5-18(6-9-21)16-31-11-3-4-12-31/h5-10,13-15H,2-4,11-12,16H2,1H3,(H,28,32)(H,29,30)/b17-13+,20-15+ |
| InChIKey | MOQMQWJLIADCGH-OWFIVAKCSA-N |
| XLogP | 5.60 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|