C26H22N4O2 — CID 146233119
5-[(2E,4E)-5-(methylideneamino)-4-phenoxypenta-2,4-dien-2-yl]-N-phenyl-1H-indazole-3-carboxamide (PubChem CID 146233119) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 5-[(2E,4E)-5-(methylideneamino)-4-phenoxypenta-2,4-dien-2-yl]-N-phenyl-1H-indazole-3-carboxamide.
| Compound Name | 5-[(2E,4E)-5-(methylideneamino)-4-phenoxypenta-2,4-dien-2-yl]-N-phenyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 146233119 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 5-[(2E,4E)-5-(methylideneamino)-4-phenoxypenta-2,4-dien-2-yl]-N-phenyl-1H-indazole-3-carboxamide |
| SMILES | C=N/C=C(\C=C(/C)c1ccc2[nH]nc(C(=O)Nc3ccccc3)c2c1)Oc1ccccc1 |
| InChI | InChI=1S/C26H22N4O2/c1-18(15-22(17-27-2)32-21-11-7-4-8-12-21)19-13-14-24-23(16-19)25(30-29-24)26(31)28-20-9-5-3-6-10-20/h3-17H,2H2,1H3,(H,28,31)(H,29,30)/b18-15+,22-17+ |
| InChIKey | HJTSOLXYVLIDCU-BEVFYSPWSA-N |
| XLogP | 5.84 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|