C17H20N4O4S — CID 118782256
[3-(3-methoxypyrazin-2-yl)phenyl]-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 118782256) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is [3-(3-methoxypyrazin-2-yl)phenyl]-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [3-(3-methoxypyrazin-2-yl)phenyl]-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 118782256 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [3-(3-methoxypyrazin-2-yl)phenyl]-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | COc1nccnc1-c1cccc(C(=O)N2CCN(S(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C17H20N4O4S/c1-25-16-15(18-6-7-19-16)13-4-3-5-14(12-13)17(22)20-8-10-21(11-9-20)26(2,23)24/h3-7,12H,8-11H2,1-2H3 |
| InChIKey | PYPMCYQPMBNRNX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |