C12H17N5OS2 — CID 118784193
N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 118784193) has the molecular formula C12H17N5OS2 and a molecular weight of 311.44 g/mol. Its IUPAC name is N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 118784193 |
| Molecular Formula | C12H17N5OS2 |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | Cc1csc(CCCNC(=O)CSc2nncn2C)n1 |
| InChI | InChI=1S/C12H17N5OS2/c1-9-6-19-11(15-9)4-3-5-13-10(18)7-20-12-16-14-8-17(12)2/h6,8H,3-5,7H2,1-2H3,(H,13,18) |
| InChIKey | VMIAPNZBLJNOGV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|