C11H15N5O2 — CID 118785680
1-(1,2-oxazol-3-ylmethyl)-3-(1,3,5-trimethylpyrazol-4-yl)urea (PubChem CID 118785680) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-(1,2-oxazol-3-ylmethyl)-3-(1,3,5-trimethylpyrazol-4-yl)urea.
| Compound Name | 1-(1,2-oxazol-3-ylmethyl)-3-(1,3,5-trimethylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 118785680 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-(1,2-oxazol-3-ylmethyl)-3-(1,3,5-trimethylpyrazol-4-yl)urea |
| SMILES | Cc1nn(C)c(C)c1NC(=O)NCc1ccon1 |
| InChI | InChI=1S/C11H15N5O2/c1-7-10(8(2)16(3)14-7)13-11(17)12-6-9-4-5-18-15-9/h4-5H,6H2,1-3H3,(H2,12,13,17) |
| InChIKey | REKRZJJXGDWEGD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |