About lead(2+);bis(1-oxidopyridine-2-thione)
lead(2+);bis(1-oxidopyridine-2-thione) (PubChem CID 118796495) has the molecular formula C10H8N2O2PbS2
and a molecular weight of 459.52 g/mol. Its IUPAC name is lead(2+);bis(1-oxidopyridine-2-thione).
Molecular Properties
| Compound Name | lead(2+);bis(1-oxidopyridine-2-thione) |
| PubChem CID | 118796495 |
| Molecular Formula | C10H8N2O2PbS2 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | lead(2+);bis(1-oxidopyridine-2-thione) |
| SMILES | [O-]n1ccccc1=S.[O-]n1ccccc1=S.[Pb+2] |
| InChI | InChI=1S/2C5H4NOS.Pb/c2*7-6-4-2-1-3-5(6)8;/h2*1-4H;/q2*-1;+2 |
| InChIKey | JQYCNWHXSGINKZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze lead(2+);bis(1-oxidopyridine-2-thione) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lead(2+);bis(1-oxidopyridine-2-thione)?
The IUPAC name of lead(2+);bis(1-oxidopyridine-2-thione) (CID 118796495) is lead(2+);bis(1-oxidopyridine-2-thione).
What is the SMILES notation for lead(2+);bis(1-oxidopyridine-2-thione)?
The canonical SMILES for lead(2+);bis(1-oxidopyridine-2-thione) is [O-]n1ccccc1=S.[O-]n1ccccc1=S.[Pb+2].
What is the InChIKey of lead(2+);bis(1-oxidopyridine-2-thione)?
The InChIKey is JQYCNWHXSGINKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H4NOS.Pb/c2*7-6-4-2-1-3-5(6)8;/h2*1-4H;/q2*-1;+2.
What are the key properties of lead(2+);bis(1-oxidopyridine-2-thione)?
lead(2+);bis(1-oxidopyridine-2-thione) has a molecular weight of 459.52 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for lead(2+);bis(1-oxidopyridine-2-thione) is sourced from PubChem (CID 118796495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).