C25H31FN4O7S — CID 11880096
methyl 4-[[(2S,4S)-4-[(3-fluorophenyl)carbamoylamino]-1-(4-methoxyphenyl)sulfonylpiperidine-2-carbonyl]amino]butanoate (PubChem CID 11880096) has the molecular formula C25H31FN4O7S and a molecular weight of 550.61 g/mol. Its IUPAC name is methyl 4-[[(2S,4S)-4-[(3-fluorophenyl)carbamoylamino]-1-(4-methoxyphenyl)sulfonylpiperidine-2-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[(2S,4S)-4-[(3-fluorophenyl)carbamoylamino]-1-(4-methoxyphenyl)sulfonylpiperidine-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 11880096 |
| Molecular Formula | C25H31FN4O7S |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | methyl 4-[[(2S,4S)-4-[(3-fluorophenyl)carbamoylamino]-1-(4-methoxyphenyl)sulfonylpiperidine-2-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)[C@@H]1C[C@@H](NC(=O)Nc2cccc(F)c2)CCN1S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H31FN4O7S/c1-36-20-8-10-21(11-9-20)38(34,35)30-14-12-19(29-25(33)28-18-6-3-5-17(26)15-18)16-22(30)24(32)27-13-4-7-23(31)37-2/h3,5-6,8-11,15,19,22H,4,7,12-14,16H2,1-2H3,(H,27,32)(H2,28,29,33)/t19-,22-/m0/s1 |
| InChIKey | MSMCFUAEHZZXEK-UGKGYDQZSA-N |
| XLogP | 2.25 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|