C8H9F2N3O2 — CID 118801026
4-amino-6-(difluoromethyl)-5-methoxypyridine-2-carboxamide (PubChem CID 118801026) has the molecular formula C8H9F2N3O2 and a molecular weight of 217.18 g/mol. Its IUPAC name is 4-amino-6-(difluoromethyl)-5-methoxypyridine-2-carboxamide.
| Compound Name | 4-amino-6-(difluoromethyl)-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 118801026 |
| Molecular Formula | C8H9F2N3O2 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 4-amino-6-(difluoromethyl)-5-methoxypyridine-2-carboxamide |
| SMILES | COc1c(N)cc(C(N)=O)nc1C(F)F |
| InChI | InChI=1S/C8H9F2N3O2/c1-15-6-3(11)2-4(8(12)14)13-5(6)7(9)10/h2,7H,1H3,(H2,11,13)(H2,12,14) |
| InChIKey | AWKLLRWIGODBFW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |