C7H8F2N4O — CID 119003054
5,6-diamino-2-(difluoromethyl)pyridine-3-carboxamide (PubChem CID 119003054) has the molecular formula C7H8F2N4O and a molecular weight of 202.16 g/mol. Its IUPAC name is 5,6-diamino-2-(difluoromethyl)pyridine-3-carboxamide.
| Compound Name | 5,6-diamino-2-(difluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 119003054 |
| Molecular Formula | C7H8F2N4O |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 5,6-diamino-2-(difluoromethyl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc(N)c(N)nc1C(F)F |
| InChI | InChI=1S/C7H8F2N4O/c8-5(9)4-2(7(12)14)1-3(10)6(11)13-4/h1,5H,10H2,(H2,11,13)(H2,12,14) |
| InChIKey | XFBKERLRLQICNG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |