C16H31N3 — CID 11880259
2-piperazin-1-yl-N-[[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]ethanamine (PubChem CID 11880259) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is 2-piperazin-1-yl-N-[[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]ethanamine.
| Compound Name | 2-piperazin-1-yl-N-[[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 11880259 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 2-piperazin-1-yl-N-[[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]ethanamine |
| SMILES | CC1=C[C@H](C)[C@H](CNCCN2CCNCC2)[C@H](C)C1 |
| InChI | InChI=1S/C16H31N3/c1-13-10-14(2)16(15(3)11-13)12-18-6-9-19-7-4-17-5-8-19/h10,14-18H,4-9,11-12H2,1-3H3/t14-,15+,16-/m0/s1 |
| InChIKey | VYWIPLBVFRKSKW-XHSDSOJGSA-N |
| XLogP | 1.72 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|