C13H14F2O4 — CID 118803628
2-(difluoromethyl)-4-(3-ethoxy-3-oxopropyl)benzoic acid (PubChem CID 118803628) has the molecular formula C13H14F2O4 and a molecular weight of 272.25 g/mol. Its IUPAC name is 2-(difluoromethyl)-4-(3-ethoxy-3-oxopropyl)benzoic acid.
| Compound Name | 2-(difluoromethyl)-4-(3-ethoxy-3-oxopropyl)benzoic acid |
|---|---|
| PubChem CID | 118803628 |
| Molecular Formula | C13H14F2O4 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-(difluoromethyl)-4-(3-ethoxy-3-oxopropyl)benzoic acid |
| SMILES | CCOC(=O)CCc1ccc(C(=O)O)c(C(F)F)c1 |
| InChI | InChI=1S/C13H14F2O4/c1-2-19-11(16)6-4-8-3-5-9(13(17)18)10(7-8)12(14)15/h3,5,7,12H,2,4,6H2,1H3,(H,17,18) |
| InChIKey | ZVCQIQZFDLDOJI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |