C15H8Cl4O2 — CID 118803820
(E)-3-[2-chloro-3-(2,4,5-trichlorophenyl)phenyl]prop-2-enoic acid (PubChem CID 118803820) has the molecular formula C15H8Cl4O2 and a molecular weight of 362.04 g/mol. Its IUPAC name is (E)-3-[2-chloro-3-(2,4,5-trichlorophenyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-chloro-3-(2,4,5-trichlorophenyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118803820 |
| Molecular Formula | C15H8Cl4O2 |
| Molecular Weight | 362.04 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | (E)-3-[2-chloro-3-(2,4,5-trichlorophenyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(-c2cc(Cl)c(Cl)cc2Cl)c1Cl |
| InChI | InChI=1S/C15H8Cl4O2/c16-11-7-13(18)12(17)6-10(11)9-3-1-2-8(15(9)19)4-5-14(20)21/h1-7H,(H,20,21)/b5-4+ |
| InChIKey | KARQKAHEQYBFLK-SNAWJCMRSA-N |
| XLogP | 6.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.04 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|