C16H10Cl3NO2 — CID 118804955
4-methoxy-5-(2,3,4-trichlorophenyl)-1H-indole-3-carbaldehyde (PubChem CID 118804955) has the molecular formula C16H10Cl3NO2 and a molecular weight of 354.62 g/mol. Its IUPAC name is 4-methoxy-5-(2,3,4-trichlorophenyl)-1H-indole-3-carbaldehyde.
| Compound Name | 4-methoxy-5-(2,3,4-trichlorophenyl)-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 118804955 |
| Molecular Formula | C16H10Cl3NO2 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 4-methoxy-5-(2,3,4-trichlorophenyl)-1H-indole-3-carbaldehyde |
| SMILES | COc1c(-c2ccc(Cl)c(Cl)c2Cl)ccc2[nH]cc(C=O)c12 |
| InChI | InChI=1S/C16H10Cl3NO2/c1-22-16-10(9-2-4-11(17)15(19)14(9)18)3-5-12-13(16)8(7-21)6-20-12/h2-7,20H,1H3 |
| InChIKey | PVNKONAEUODJHY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|