C15H7Cl3FNO — CID 118833060
4-fluoro-7-(2,3,4-trichlorophenyl)-1H-indole-3-carbaldehyde (PubChem CID 118833060) has the molecular formula C15H7Cl3FNO and a molecular weight of 342.58 g/mol. Its IUPAC name is 4-fluoro-7-(2,3,4-trichlorophenyl)-1H-indole-3-carbaldehyde.
| Compound Name | 4-fluoro-7-(2,3,4-trichlorophenyl)-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 118833060 |
| Molecular Formula | C15H7Cl3FNO |
| Molecular Weight | 342.58 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | 4-fluoro-7-(2,3,4-trichlorophenyl)-1H-indole-3-carbaldehyde |
| SMILES | O=Cc1c[nH]c2c(-c3ccc(Cl)c(Cl)c3Cl)ccc(F)c12 |
| InChI | InChI=1S/C15H7Cl3FNO/c16-10-3-1-8(13(17)14(10)18)9-2-4-11(19)12-7(6-21)5-20-15(9)12/h1-6,20H |
| InChIKey | TXGJJBUHFCGKDY-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|