C10H6F2N2O2 — CID 21071471
4,7-difluoro-3-[(E)-2-nitroethenyl]-1H-indole (PubChem CID 21071471) has the molecular formula C10H6F2N2O2 and a molecular weight of 224.17 g/mol. Its IUPAC name is 4,7-difluoro-3-[(E)-2-nitroethenyl]-1H-indole.
| Compound Name | 4,7-difluoro-3-[(E)-2-nitroethenyl]-1H-indole |
|---|---|
| PubChem CID | 21071471 |
| Molecular Formula | C10H6F2N2O2 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 4,7-difluoro-3-[(E)-2-nitroethenyl]-1H-indole |
| SMILES | O=[N+]([O-])/C=C/c1c[nH]c2c(F)ccc(F)c12 |
| InChI | InChI=1S/C10H6F2N2O2/c11-7-1-2-8(12)10-9(7)6(5-13-10)3-4-14(15)16/h1-5,13H/b4-3+ |
| InChIKey | JDAPUPJTOOIQJM-ONEGZZNKSA-N |
| XLogP | 2.69 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|