C7H5F5N2O — CID 118812288
2-(difluoromethyl)-3-(trifluoromethoxy)pyridin-4-amine (PubChem CID 118812288) has the molecular formula C7H5F5N2O and a molecular weight of 228.12 g/mol. Its IUPAC name is 2-(difluoromethyl)-3-(trifluoromethoxy)pyridin-4-amine.
| Compound Name | 2-(difluoromethyl)-3-(trifluoromethoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 118812288 |
| Molecular Formula | C7H5F5N2O |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 2-(difluoromethyl)-3-(trifluoromethoxy)pyridin-4-amine |
| SMILES | Nc1ccnc(C(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C7H5F5N2O/c8-6(9)4-5(15-7(10,11)12)3(13)1-2-14-4/h1-2,6H,(H2,13,14) |
| InChIKey | QELICGCGOGYRIK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |