C18H16N3O2+ — CID 11881350
(3S,4R,5R)-4-(4-methylphenyl)-2,6-dioxo-5-pyridin-1-ium-1-ylpiperidine-3-carbonitrile (PubChem CID 11881350) has the molecular formula C18H16N3O2+ and a molecular weight of 306.35 g/mol. Its IUPAC name is (3S,4R,5R)-4-(4-methylphenyl)-2,6-dioxo-5-pyridin-1-ium-1-ylpiperidine-3-carbonitrile.
| Compound Name | (3S,4R,5R)-4-(4-methylphenyl)-2,6-dioxo-5-pyridin-1-ium-1-ylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 11881350 |
| Molecular Formula | C18H16N3O2+ |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (3S,4R,5R)-4-(4-methylphenyl)-2,6-dioxo-5-pyridin-1-ium-1-ylpiperidine-3-carbonitrile |
| SMILES | Cc1ccc([C@H]2[C@@H](C#N)C(=O)NC(=O)[C@@H]2[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N3O2/c1-12-5-7-13(8-6-12)15-14(11-19)17(22)20-18(23)16(15)21-9-3-2-4-10-21/h2-10,14-16H,1H3/p+1/t14-,15+,16-/m1/s1 |
| InChIKey | BRCBDFVVQDFCLW-OWCLPIDISA-O |
| XLogP | 1.40 |
| TPSA | 73.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|