C19H19N4O2+ — CID 7312985
(3S,4S)-4-[4-(dimethylamino)phenyl]-6-hydroxy-2-oxo-3-pyridin-1-ium-1-yl-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 7312985) has the molecular formula C19H19N4O2+ and a molecular weight of 335.39 g/mol. Its IUPAC name is (3S,4S)-4-[4-(dimethylamino)phenyl]-6-hydroxy-2-oxo-3-pyridin-1-ium-1-yl-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | (3S,4S)-4-[4-(dimethylamino)phenyl]-6-hydroxy-2-oxo-3-pyridin-1-ium-1-yl-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 7312985 |
| Molecular Formula | C19H19N4O2+ |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (3S,4S)-4-[4-(dimethylamino)phenyl]-6-hydroxy-2-oxo-3-pyridin-1-ium-1-yl-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | CN(C)c1ccc([C@H]2C(C#N)=C(O)NC(=O)[C@H]2[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N4O2/c1-22(2)14-8-6-13(7-9-14)16-15(12-20)18(24)21-19(25)17(16)23-10-4-3-5-11-23/h3-11,16-17H,1-2H3,(H-,21,24,25)/p+1/t16-,17-/m0/s1 |
| InChIKey | HHIWBSAJJLGZPZ-IRXDYDNUSA-O |
| XLogP | 1.79 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|