C18H17ClN3OS+ — CID 28958742
(2R,3S,4R)-4-(4-chlorophenyl)-2-hydroxy-2-methyl-3-pyridin-1-ium-1-yl-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 28958742) has the molecular formula C18H17ClN3OS+ and a molecular weight of 358.87 g/mol. Its IUPAC name is (2R,3S,4R)-4-(4-chlorophenyl)-2-hydroxy-2-methyl-3-pyridin-1-ium-1-yl-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | (2R,3S,4R)-4-(4-chlorophenyl)-2-hydroxy-2-methyl-3-pyridin-1-ium-1-yl-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 28958742 |
| Molecular Formula | C18H17ClN3OS+ |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | (2R,3S,4R)-4-(4-chlorophenyl)-2-hydroxy-2-methyl-3-pyridin-1-ium-1-yl-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | C[C@]1(O)NC(S)=C(C#N)[C@@H](c2ccc(Cl)cc2)[C@@H]1[n+]1ccccc1 |
| InChI | InChI=1S/C18H16ClN3OS/c1-18(23)16(22-9-3-2-4-10-22)15(14(11-20)17(24)21-18)12-5-7-13(19)8-6-12/h2-10,15-16,21,23H,1H3/p+1/t15-,16+,18-/m1/s1 |
| InChIKey | UUHKKRHAOIPVPD-SOLBZPMBSA-O |
| XLogP | 2.93 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|