C26H20N5O+ — CID 98614124
(2R,3R,4R)-6-(1-cyano-2-iminoethenyl)-2-hydroxy-2,4-diphenyl-3-pyridin-1-ium-1-yl-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 98614124) has the molecular formula C26H20N5O+ and a molecular weight of 418.48 g/mol. Its IUPAC name is (2R,3R,4R)-6-(1-cyano-2-iminoethenyl)-2-hydroxy-2,4-diphenyl-3-pyridin-1-ium-1-yl-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | (2R,3R,4R)-6-(1-cyano-2-iminoethenyl)-2-hydroxy-2,4-diphenyl-3-pyridin-1-ium-1-yl-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 98614124 |
| Molecular Formula | C26H20N5O+ |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (2R,3R,4R)-6-(1-cyano-2-iminoethenyl)-2-hydroxy-2,4-diphenyl-3-pyridin-1-ium-1-yl-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | N#CC(=C=N)C1=C(C#N)[C@@H](c2ccccc2)[C@@H]([n+]2ccccc2)[C@](O)(c2ccccc2)N1 |
| InChI | InChI=1S/C26H20N5O/c27-16-20(17-28)24-22(18-29)23(19-10-4-1-5-11-19)25(31-14-8-3-9-15-31)26(32,30-24)21-12-6-2-7-13-21/h1-15,23,25,27,30,32H/q+1/t23-,25-,26-/m1/s1 |
| InChIKey | IYAXXDXWSQKODI-LGPLSSKUSA-N |
| XLogP | 3.22 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|