C24H20BrN5O — CID 99975099
[2-[(2R,3R,4R)-4-(4-bromophenyl)-5-cyano-2-cyclopropyl-2-hydroxy-3-(2-methylpyridin-1-ium-1-yl)-3,4-dihydro-1H-pyridin-6-yl]-2-cyanoethenylidene]azanide (PubChem CID 99975099) has the molecular formula C24H20BrN5O and a molecular weight of 474.36 g/mol. Its IUPAC name is [2-[(2R,3R,4R)-4-(4-bromophenyl)-5-cyano-2-cyclopropyl-2-hydroxy-3-(2-methylpyridin-1-ium-1-yl)-3,4-dihydro-1H-pyridin-6-yl]-2-cyanoethenylidene]azanide.
| Compound Name | [2-[(2R,3R,4R)-4-(4-bromophenyl)-5-cyano-2-cyclopropyl-2-hydroxy-3-(2-methylpyridin-1-ium-1-yl)-3,4-dihydro-1H-pyridin-6-yl]-2-cyanoethenylidene]azanide |
|---|---|
| PubChem CID | 99975099 |
| Molecular Formula | C24H20BrN5O |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | [2-[(2R,3R,4R)-4-(4-bromophenyl)-5-cyano-2-cyclopropyl-2-hydroxy-3-(2-methylpyridin-1-ium-1-yl)-3,4-dihydro-1H-pyridin-6-yl]-2-cyanoethenylidene]azanide |
| SMILES | Cc1cccc[n+]1[C@@H]1[C@H](c2ccc(Br)cc2)C(C#N)=C(C(=C=[N-])C#N)N[C@@]1(O)C1CC1 |
| InChI | InChI=1S/C24H20BrN5O/c1-15-4-2-3-11-30(15)23-21(16-5-9-19(25)10-6-16)20(14-28)22(17(12-26)13-27)29-24(23,31)18-7-8-18/h2-6,9-11,18,21,23,29,31H,7-8H2,1H3/t21-,23-,24-/m1/s1 |
| InChIKey | BUIVVPFEMFIUSN-GMKZXUHWSA-N |
| XLogP | 3.54 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|