C24H22N5O+ — CID 7206414
(3S,4R,5S,6S)-2-(1-cyano-2-iminoethenyl)-6-cyclopropyl-6-hydroxy-5-(2-methylpyridin-1-ium-1-yl)-4-phenyl-4,5-dihydro-3H-pyridine-3-carbonitrile (PubChem CID 7206414) has the molecular formula C24H22N5O+ and a molecular weight of 396.47 g/mol. Its IUPAC name is (3S,4R,5S,6S)-2-(1-cyano-2-iminoethenyl)-6-cyclopropyl-6-hydroxy-5-(2-methylpyridin-1-ium-1-yl)-4-phenyl-4,5-dihydro-3H-pyridine-3-carbonitrile.
| Compound Name | (3S,4R,5S,6S)-2-(1-cyano-2-iminoethenyl)-6-cyclopropyl-6-hydroxy-5-(2-methylpyridin-1-ium-1-yl)-4-phenyl-4,5-dihydro-3H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 7206414 |
| Molecular Formula | C24H22N5O+ |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (3S,4R,5S,6S)-2-(1-cyano-2-iminoethenyl)-6-cyclopropyl-6-hydroxy-5-(2-methylpyridin-1-ium-1-yl)-4-phenyl-4,5-dihydro-3H-pyridine-3-carbonitrile |
| SMILES | Cc1cccc[n+]1[C@H]1[C@@H](c2ccccc2)[C@H](C#N)C(C(=C=N)C#N)=N[C@]1(O)C1CC1 |
| InChI | InChI=1S/C24H22N5O/c1-16-7-5-6-12-29(16)23-21(17-8-3-2-4-9-17)20(15-27)22(18(13-25)14-26)28-24(23,30)19-10-11-19/h2-9,12,19-21,23,25,30H,10-11H2,1H3/q+1/t20-,21-,23-,24-/m0/s1 |
| InChIKey | FJCVGSKKWGENGV-WMIMKTLMSA-N |
| XLogP | 3.00 |
| TPSA | 107.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|