C16H9ClN6 — CID 7336478
(4R)-2-amino-4-(2-chlorophenyl)-6-(1-cyano-2-iminoethenyl)-3,4-dihydropyridine-3,5-dicarbonitrile (PubChem CID 7336478) has the molecular formula C16H9ClN6 and a molecular weight of 320.74 g/mol. Its IUPAC name is (4R)-2-amino-4-(2-chlorophenyl)-6-(1-cyano-2-iminoethenyl)-3,4-dihydropyridine-3,5-dicarbonitrile.
| Compound Name | (4R)-2-amino-4-(2-chlorophenyl)-6-(1-cyano-2-iminoethenyl)-3,4-dihydropyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 7336478 |
| Molecular Formula | C16H9ClN6 |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (4R)-2-amino-4-(2-chlorophenyl)-6-(1-cyano-2-iminoethenyl)-3,4-dihydropyridine-3,5-dicarbonitrile |
| SMILES | N#CC(=C=N)C1=C(C#N)[C@H](c2ccccc2Cl)C(C#N)C(N)=N1 |
| InChI | InChI=1S/C16H9ClN6/c17-13-4-2-1-3-10(13)14-11(7-20)15(9(5-18)6-19)23-16(22)12(14)8-21/h1-4,12,14,18H,(H2,22,23)/t12?,14-/m0/s1 |
| InChIKey | DNMCKXYZISLEFL-PYMCNQPYSA-N |
| XLogP | 2.41 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|