C13H11ClN4OS — CID 7358664
(4R)-2-amino-4-(3-chlorophenyl)-3-cyano-6-sulfanyl-3,4-dihydropyridine-5-carboxamide (PubChem CID 7358664) has the molecular formula C13H11ClN4OS and a molecular weight of 306.78 g/mol. Its IUPAC name is (4R)-2-amino-4-(3-chlorophenyl)-3-cyano-6-sulfanyl-3,4-dihydropyridine-5-carboxamide.
| Compound Name | (4R)-2-amino-4-(3-chlorophenyl)-3-cyano-6-sulfanyl-3,4-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 7358664 |
| Molecular Formula | C13H11ClN4OS |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (4R)-2-amino-4-(3-chlorophenyl)-3-cyano-6-sulfanyl-3,4-dihydropyridine-5-carboxamide |
| SMILES | N#CC1C(N)=NC(S)=C(C(N)=O)[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H11ClN4OS/c14-7-3-1-2-6(4-7)9-8(5-15)11(16)18-13(20)10(9)12(17)19/h1-4,8-9,20H,(H2,16,18)(H2,17,19)/t8?,9-/m0/s1 |
| InChIKey | QGKUFLHEUCVSLZ-GKAPJAKFSA-N |
| XLogP | 1.56 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|