C13H11ClN4S — CID 73450753
2-amino-4-(2-chlorophenyl)-6-sulfanylidenepiperidine-3,5-dicarbonitrile (PubChem CID 73450753) has the molecular formula C13H11ClN4S and a molecular weight of 290.78 g/mol. Its IUPAC name is 2-amino-4-(2-chlorophenyl)-6-sulfanylidenepiperidine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(2-chlorophenyl)-6-sulfanylidenepiperidine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 73450753 |
| Molecular Formula | C13H11ClN4S |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-amino-4-(2-chlorophenyl)-6-sulfanylidenepiperidine-3,5-dicarbonitrile |
| SMILES | N#CC1C(=S)NC(N)C(C#N)C1c1ccccc1Cl |
| InChI | InChI=1S/C13H11ClN4S/c14-10-4-2-1-3-7(10)11-8(5-15)12(17)18-13(19)9(11)6-16/h1-4,8-9,11-12H,17H2,(H,18,19) |
| InChIKey | GHSRUQKHBPZEPP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|