C25H23N5O2 — CID 98155539
[2-cyano-2-[(2S,3S,4R)-5-cyano-2-cyclopropyl-2-hydroxy-4-(2-methoxyphenyl)-3-(4-methylpyridin-1-ium-1-yl)-3,4-dihydro-1H-pyridin-6-yl]ethenylidene]azanide (PubChem CID 98155539) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is [2-cyano-2-[(2S,3S,4R)-5-cyano-2-cyclopropyl-2-hydroxy-4-(2-methoxyphenyl)-3-(4-methylpyridin-1-ium-1-yl)-3,4-dihydro-1H-pyridin-6-yl]ethenylidene]azanide.
| Compound Name | [2-cyano-2-[(2S,3S,4R)-5-cyano-2-cyclopropyl-2-hydroxy-4-(2-methoxyphenyl)-3-(4-methylpyridin-1-ium-1-yl)-3,4-dihydro-1H-pyridin-6-yl]ethenylidene]azanide |
|---|---|
| PubChem CID | 98155539 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | [2-cyano-2-[(2S,3S,4R)-5-cyano-2-cyclopropyl-2-hydroxy-4-(2-methoxyphenyl)-3-(4-methylpyridin-1-ium-1-yl)-3,4-dihydro-1H-pyridin-6-yl]ethenylidene]azanide |
| SMILES | COc1ccccc1[C@H]1C(C#N)=C(C(=C=[N-])C#N)N[C@](O)(C2CC2)[C@H]1[n+]1ccc(C)cc1 |
| InChI | InChI=1S/C25H23N5O2/c1-16-9-11-30(12-10-16)24-22(19-5-3-4-6-21(19)32-2)20(15-28)23(17(13-26)14-27)29-25(24,31)18-7-8-18/h3-6,9-12,18,22,24,29,31H,7-8H2,1-2H3/t22-,24-,25-/m0/s1 |
| InChIKey | RPIBSEOCTLNUGI-HVCNVCAESA-N |
| XLogP | 2.78 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|