C25H20N5OS+ — CID 99721259
(2R,3R,4R)-6-(1-cyano-2-iminoethenyl)-2-hydroxy-3-(3-methylpyridin-1-ium-1-yl)-2-phenyl-4-thiophen-2-yl-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 99721259) has the molecular formula C25H20N5OS+ and a molecular weight of 438.54 g/mol. Its IUPAC name is (2R,3R,4R)-6-(1-cyano-2-iminoethenyl)-2-hydroxy-3-(3-methylpyridin-1-ium-1-yl)-2-phenyl-4-thiophen-2-yl-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | (2R,3R,4R)-6-(1-cyano-2-iminoethenyl)-2-hydroxy-3-(3-methylpyridin-1-ium-1-yl)-2-phenyl-4-thiophen-2-yl-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 99721259 |
| Molecular Formula | C25H20N5OS+ |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (2R,3R,4R)-6-(1-cyano-2-iminoethenyl)-2-hydroxy-3-(3-methylpyridin-1-ium-1-yl)-2-phenyl-4-thiophen-2-yl-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | Cc1ccc[n+]([C@@H]2[C@H](c3cccs3)C(C#N)=C(C(=C=N)C#N)N[C@@]2(O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H20N5OS/c1-17-7-5-11-30(16-17)24-22(21-10-6-12-32-21)20(15-28)23(18(13-26)14-27)29-25(24,31)19-8-3-2-4-9-19/h2-12,16,22,24,26,29,31H,1H3/q+1/t22-,24+,25+/m0/s1 |
| InChIKey | VTGUYKQASLNQOV-ICDZXHCJSA-N |
| XLogP | 3.59 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|