C26H21N4OS+ — CID 3532795
2-hydroxy-3-isoquinolin-2-ium-2-yl-2-phenyl-4-pyridin-4-yl-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 3532795) has the molecular formula C26H21N4OS+ and a molecular weight of 437.55 g/mol. Its IUPAC name is 2-hydroxy-3-isoquinolin-2-ium-2-yl-2-phenyl-4-pyridin-4-yl-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | 2-hydroxy-3-isoquinolin-2-ium-2-yl-2-phenyl-4-pyridin-4-yl-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 3532795 |
| Molecular Formula | C26H21N4OS+ |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-hydroxy-3-isoquinolin-2-ium-2-yl-2-phenyl-4-pyridin-4-yl-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | N#CC1=C(S)NC(O)(c2ccccc2)C([n+]2ccc3ccccc3c2)C1c1ccncc1 |
| InChI | InChI=1S/C26H20N4OS/c27-16-22-23(19-10-13-28-14-11-19)24(30-15-12-18-6-4-5-7-20(18)17-30)26(31,29-25(22)32)21-8-2-1-3-9-21/h1-15,17,23-24,29,31H/p+1 |
| InChIKey | HCLBAVOYELLEJT-UHFFFAOYSA-O |
| XLogP | 3.96 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|